C21H16F4N2O3 — CID 18272984
N-[4-[3-(4-fluorophenyl)propanoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 18272984) has the molecular formula C21H16F4N2O3 and a molecular weight of 420.36 g/mol. Its IUPAC name is N-[4-[3-(4-fluorophenyl)propanoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[3-(4-fluorophenyl)propanoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 18272984 |
| Molecular Formula | C21H16F4N2O3 |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-[4-[3-(4-fluorophenyl)propanoylamino]-3-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(CCc1ccc(F)cc1)Nc1ccc(NC(=O)c2ccco2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H16F4N2O3/c22-14-6-3-13(4-7-14)5-10-19(28)27-17-9-8-15(12-16(17)21(23,24)25)26-20(29)18-2-1-11-30-18/h1-4,6-9,11-12H,5,10H2,(H,26,29)(H,27,28) |
| InChIKey | YQFHMBRXUCJWRZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |