C20H18N2O4 — CID 17359487
N-[3-hydroxy-4-(3-phenylpropanoylamino)phenyl]furan-2-carboxamide (PubChem CID 17359487) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is N-[3-hydroxy-4-(3-phenylpropanoylamino)phenyl]furan-2-carboxamide.
| Compound Name | N-[3-hydroxy-4-(3-phenylpropanoylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17359487 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | N-[3-hydroxy-4-(3-phenylpropanoylamino)phenyl]furan-2-carboxamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(NC(=O)c2ccco2)cc1O |
| InChI | InChI=1S/C20H18N2O4/c23-17-13-15(21-20(25)18-7-4-12-26-18)9-10-16(17)22-19(24)11-8-14-5-2-1-3-6-14/h1-7,9-10,12-13,23H,8,11H2,(H,21,25)(H,22,24) |
| InChIKey | CLTYSPLCXYTBHE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|