C24H26N2O5 — CID 1441351
N-[2,5-diethoxy-4-(3-phenylpropanoylamino)phenyl]furan-2-carboxamide (PubChem CID 1441351) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-(3-phenylpropanoylamino)phenyl]furan-2-carboxamide.
| Compound Name | N-[2,5-diethoxy-4-(3-phenylpropanoylamino)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1441351 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[2,5-diethoxy-4-(3-phenylpropanoylamino)phenyl]furan-2-carboxamide |
| SMILES | CCOc1cc(NC(=O)c2ccco2)c(OCC)cc1NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C24H26N2O5/c1-3-29-21-16-19(26-24(28)20-11-8-14-31-20)22(30-4-2)15-18(21)25-23(27)13-12-17-9-6-5-7-10-17/h5-11,14-16H,3-4,12-13H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | GZFWTYROHRGTEZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |