C24H26N2O4S — CID 18282158
N-[2,5-diethoxy-4-(3-thiophen-3-ylpropanoylamino)phenyl]benzamide (PubChem CID 18282158) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-(3-thiophen-3-ylpropanoylamino)phenyl]benzamide.
| Compound Name | N-[2,5-diethoxy-4-(3-thiophen-3-ylpropanoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 18282158 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[2,5-diethoxy-4-(3-thiophen-3-ylpropanoylamino)phenyl]benzamide |
| SMILES | CCOc1cc(NC(=O)c2ccccc2)c(OCC)cc1NC(=O)CCc1ccsc1 |
| InChI | InChI=1S/C24H26N2O4S/c1-3-29-21-15-20(26-24(28)18-8-6-5-7-9-18)22(30-4-2)14-19(21)25-23(27)11-10-17-12-13-31-16-17/h5-9,12-16H,3-4,10-11H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | MCVHNRUGBIZGRN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |