C28H32N2O5 — CID 108795827
N-[2,5-diethoxy-4-[3-(4-ethylphenoxy)propanoylamino]phenyl]benzamide (PubChem CID 108795827) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[3-(4-ethylphenoxy)propanoylamino]phenyl]benzamide.
| Compound Name | N-[2,5-diethoxy-4-[3-(4-ethylphenoxy)propanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 108795827 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | N-[2,5-diethoxy-4-[3-(4-ethylphenoxy)propanoylamino]phenyl]benzamide |
| SMILES | CCOc1cc(NC(=O)c2ccccc2)c(OCC)cc1NC(=O)CCOc1ccc(CC)cc1 |
| InChI | InChI=1S/C28H32N2O5/c1-4-20-12-14-22(15-13-20)35-17-16-27(31)29-23-18-26(34-6-3)24(19-25(23)33-5-2)30-28(32)21-10-8-7-9-11-21/h7-15,18-19H,4-6,16-17H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | ARWXGFBBSVUNQH-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |