C32H40N2O5 — CID 19237102
N-[2,5-diethoxy-4-[4-[4-(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]benzamide (PubChem CID 19237102) has the molecular formula C32H40N2O5 and a molecular weight of 532.68 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-[4-[4-(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]benzamide.
| Compound Name | N-[2,5-diethoxy-4-[4-[4-(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 19237102 |
| Molecular Formula | C32H40N2O5 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | N-[2,5-diethoxy-4-[4-[4-(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]benzamide |
| SMILES | CCOc1cc(NC(=O)c2ccccc2)c(OCC)cc1NC(=O)CCCOc1ccc(C(C)(C)CC)cc1 |
| InChI | InChI=1S/C32H40N2O5/c1-6-32(4,5)24-16-18-25(19-17-24)39-20-12-15-30(35)33-26-21-29(38-8-3)27(22-28(26)37-7-2)34-31(36)23-13-10-9-11-14-23/h9-11,13-14,16-19,21-22H,6-8,12,15,20H2,1-5H3,(H,33,35)(H,34,36) |
| InChIKey | QZOCKAIHQDWQQO-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|