C25H34N2O4 — CID 1428135
N-[4-(butanoylamino)-2,5-diethoxyphenyl]-4-tert-butylbenzamide (PubChem CID 1428135) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[4-(butanoylamino)-2,5-diethoxyphenyl]-4-tert-butylbenzamide.
| Compound Name | N-[4-(butanoylamino)-2,5-diethoxyphenyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 1428135 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | N-[4-(butanoylamino)-2,5-diethoxyphenyl]-4-tert-butylbenzamide |
| SMILES | CCCC(=O)Nc1cc(OCC)c(NC(=O)c2ccc(C(C)(C)C)cc2)cc1OCC |
| InChI | InChI=1S/C25H34N2O4/c1-7-10-23(28)26-19-15-22(31-9-3)20(16-21(19)30-8-2)27-24(29)17-11-13-18(14-12-17)25(4,5)6/h11-16H,7-10H2,1-6H3,(H,26,28)(H,27,29) |
| InChIKey | SBKNGIWJJLLOQG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |