C18H26N2O4 — CID 1428132
N-[4-(butanoylamino)-2,5-diethoxyphenyl]cyclopropanecarboxamide (PubChem CID 1428132) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[4-(butanoylamino)-2,5-diethoxyphenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-(butanoylamino)-2,5-diethoxyphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 1428132 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-[4-(butanoylamino)-2,5-diethoxyphenyl]cyclopropanecarboxamide |
| SMILES | CCCC(=O)Nc1cc(OCC)c(NC(=O)C2CC2)cc1OCC |
| InChI | InChI=1S/C18H26N2O4/c1-4-7-17(21)19-13-10-16(24-6-3)14(11-15(13)23-5-2)20-18(22)12-8-9-12/h10-12H,4-9H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | HKBMATXYTRYQOM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |