C17H23ClN2O4 — CID 3173030
N-[4-(3-chloropropanoylamino)-2,5-diethoxyphenyl]cyclopropanecarboxamide (PubChem CID 3173030) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is N-[4-(3-chloropropanoylamino)-2,5-diethoxyphenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-(3-chloropropanoylamino)-2,5-diethoxyphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 3173030 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-[4-(3-chloropropanoylamino)-2,5-diethoxyphenyl]cyclopropanecarboxamide |
| SMILES | CCOc1cc(NC(=O)C2CC2)c(OCC)cc1NC(=O)CCCl |
| InChI | InChI=1S/C17H23ClN2O4/c1-3-23-14-10-13(20-17(22)11-5-6-11)15(24-4-2)9-12(14)19-16(21)7-8-18/h9-11H,3-8H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | DGJIHVGTFSXOMO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|