C18H21ClN2O4S — CID 3690006
N-[4-(3-chloropropanoylamino)-2,5-diethoxyphenyl]thiophene-2-carboxamide (PubChem CID 3690006) has the molecular formula C18H21ClN2O4S and a molecular weight of 396.90 g/mol. Its IUPAC name is N-[4-(3-chloropropanoylamino)-2,5-diethoxyphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-(3-chloropropanoylamino)-2,5-diethoxyphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3690006 |
| Molecular Formula | C18H21ClN2O4S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-[4-(3-chloropropanoylamino)-2,5-diethoxyphenyl]thiophene-2-carboxamide |
| SMILES | CCOc1cc(NC(=O)c2cccs2)c(OCC)cc1NC(=O)CCCl |
| InChI | InChI=1S/C18H21ClN2O4S/c1-3-24-14-11-13(21-18(23)16-6-5-9-26-16)15(25-4-2)10-12(14)20-17(22)7-8-19/h5-6,9-11H,3-4,7-8H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | NJJKAARRUPGBRD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|