C23H34N4O3S2 — CID 3186757
N-[4-[3-(diethylamino)propylcarbamothioylamino]-2,5-diethoxyphenyl]thiophene-2-carboxamide (PubChem CID 3186757) has the molecular formula C23H34N4O3S2 and a molecular weight of 478.68 g/mol. Its IUPAC name is N-[4-[3-(diethylamino)propylcarbamothioylamino]-2,5-diethoxyphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[3-(diethylamino)propylcarbamothioylamino]-2,5-diethoxyphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 3186757 |
| Molecular Formula | C23H34N4O3S2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | N-[4-[3-(diethylamino)propylcarbamothioylamino]-2,5-diethoxyphenyl]thiophene-2-carboxamide |
| SMILES | CCOc1cc(NC(=S)NCCCN(CC)CC)c(OCC)cc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C23H34N4O3S2/c1-5-27(6-2)13-10-12-24-23(31)26-18-16-19(29-7-3)17(15-20(18)30-8-4)25-22(28)21-11-9-14-32-21/h9,11,14-16H,5-8,10,12-13H2,1-4H3,(H,25,28)(H2,24,26,31) |
| InChIKey | DXLSHCFWUNUBHJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|