C20H24N2O5S — CID 1138798
(2S)-N-[2,5-diethoxy-4-(thiophene-2-carbonylamino)phenyl]oxolane-2-carboxamide (PubChem CID 1138798) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is (2S)-N-[2,5-diethoxy-4-(thiophene-2-carbonylamino)phenyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[2,5-diethoxy-4-(thiophene-2-carbonylamino)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 1138798 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2S)-N-[2,5-diethoxy-4-(thiophene-2-carbonylamino)phenyl]oxolane-2-carboxamide |
| SMILES | CCOc1cc(NC(=O)[C@@H]2CCCO2)c(OCC)cc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C20H24N2O5S/c1-3-25-16-12-14(22-20(24)18-8-6-10-28-18)17(26-4-2)11-13(16)21-19(23)15-7-5-9-27-15/h6,8,10-12,15H,3-5,7,9H2,1-2H3,(H,21,23)(H,22,24)/t15-/m0/s1 |
| InChIKey | YZAGGBFFKCZKKP-HNNXBMFYSA-N |
| XLogP | 3.92 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |