About N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide
N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide (PubChem CID 3186775) has the molecular formula C20H31N3O4S
and a molecular weight of 409.55 g/mol. Its IUPAC name is N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide.
Molecular Properties
| Compound Name | N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide |
| PubChem CID | 3186775 |
| Molecular Formula | C20H31N3O4S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide |
| SMILES | CCOCCCNC(=S)Nc1cc(OCC)c(NC(=O)C2CC2)cc1OCC |
| InChI | InChI=1S/C20H31N3O4S/c1-4-25-11-7-10-21-20(28)23-16-13-17(26-5-2)15(12-18(16)27-6-3)22-19(24)14-8-9-14/h12-14H,4-11H2,1-3H3,(H,22,24)(H2,21,23,28) |
| InChIKey | XMIPSSXCNIQQHL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide?
The IUPAC name of N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide (CID 3186775) is N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide.
What is the SMILES notation for N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide?
The canonical SMILES for N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide is CCOCCCNC(=S)Nc1cc(OCC)c(NC(=O)C2CC2)cc1OCC.
What is the InChIKey of N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide?
The InChIKey is XMIPSSXCNIQQHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N3O4S/c1-4-25-11-7-10-21-20(28)23-16-13-17(26-5-2)15(12-18(16)27-6-3)22-19(24)14-8-9-14/h12-14H,4-11H2,1-3H3,(H,22,24)(H2,21,23,28).
What are the key properties of N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide?
N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide has a molecular weight of 409.55 g/mol, XLogP of 3.55, 12 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,5-diethoxy-4-(3-ethoxypropylcarbamothioylamino)phenyl]cyclopropanecarboxamide is sourced from PubChem (CID 3186775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).