C13H19BrN2OS — CID 116509706
1-(2-bromo-5-methylphenyl)-3-(3-ethoxypropyl)thiourea (PubChem CID 116509706) has the molecular formula C13H19BrN2OS and a molecular weight of 331.28 g/mol. Its IUPAC name is 1-(2-bromo-5-methylphenyl)-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-(2-bromo-5-methylphenyl)-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 116509706 |
| Molecular Formula | C13H19BrN2OS |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 1-(2-bromo-5-methylphenyl)-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)Nc1cc(C)ccc1Br |
| InChI | InChI=1S/C13H19BrN2OS/c1-3-17-8-4-7-15-13(18)16-12-9-10(2)5-6-11(12)14/h5-6,9H,3-4,7-8H2,1-2H3,(H2,15,16,18) |
| InChIKey | VKWFIWMYHRYXMG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|