C12H16ClFN2OS — CID 113231125
1-(2-chloro-5-fluorophenyl)-3-(3-ethoxypropyl)thiourea (PubChem CID 113231125) has the molecular formula C12H16ClFN2OS and a molecular weight of 290.79 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 113231125 |
| Molecular Formula | C12H16ClFN2OS |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)Nc1cc(F)ccc1Cl |
| InChI | InChI=1S/C12H16ClFN2OS/c1-2-17-7-3-6-15-12(18)16-11-8-9(14)4-5-10(11)13/h4-5,8H,2-3,6-7H2,1H3,(H2,15,16,18) |
| InChIKey | IYZOKXNUFMUWKZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|