C12H16BrClN2OS — CID 115687528
1-(3-bromo-4-chlorophenyl)-3-(3-ethoxypropyl)thiourea (PubChem CID 115687528) has the molecular formula C12H16BrClN2OS and a molecular weight of 351.70 g/mol. Its IUPAC name is 1-(3-bromo-4-chlorophenyl)-3-(3-ethoxypropyl)thiourea.
| Compound Name | 1-(3-bromo-4-chlorophenyl)-3-(3-ethoxypropyl)thiourea |
|---|---|
| PubChem CID | 115687528 |
| Molecular Formula | C12H16BrClN2OS |
| Molecular Weight | 351.70 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | 1-(3-bromo-4-chlorophenyl)-3-(3-ethoxypropyl)thiourea |
| SMILES | CCOCCCNC(=S)Nc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H16BrClN2OS/c1-2-17-7-3-6-15-12(18)16-9-4-5-11(14)10(13)8-9/h4-5,8H,2-3,6-7H2,1H3,(H2,15,16,18) |
| InChIKey | QTCDTOYACOWMJP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.70 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|