C13H18BrClN2OS — CID 3732549
1-(4-bromo-3-chlorophenyl)-3-(3-propoxypropyl)thiourea (PubChem CID 3732549) has the molecular formula C13H18BrClN2OS and a molecular weight of 365.72 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-(3-propoxypropyl)thiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-(3-propoxypropyl)thiourea |
|---|---|
| PubChem CID | 3732549 |
| Molecular Formula | C13H18BrClN2OS |
| Molecular Weight | 365.72 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-(3-propoxypropyl)thiourea |
| SMILES | CCCOCCCNC(=S)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C13H18BrClN2OS/c1-2-7-18-8-3-6-16-13(19)17-10-4-5-11(14)12(15)9-10/h4-5,9H,2-3,6-8H2,1H3,(H2,16,17,19) |
| InChIKey | HLKAWXGEZLLQDR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.72 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|