C10H10BrClN2S — CID 19687650
1-(4-bromo-3-chlorophenyl)-3-prop-2-enylthiourea (PubChem CID 19687650) has the molecular formula C10H10BrClN2S and a molecular weight of 305.63 g/mol. Its IUPAC name is 1-(4-bromo-3-chlorophenyl)-3-prop-2-enylthiourea.
| Compound Name | 1-(4-bromo-3-chlorophenyl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 19687650 |
| Molecular Formula | C10H10BrClN2S |
| Molecular Weight | 305.63 g/mol |
| Exact Mass | 303.94 |
| IUPAC Name | 1-(4-bromo-3-chlorophenyl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C10H10BrClN2S/c1-2-5-13-10(15)14-7-3-4-8(11)9(12)6-7/h2-4,6H,1,5H2,(H2,13,14,15) |
| InChIKey | GZXUUSHYFMNLOE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.63 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|