C11H11ClF2N2OS — CID 2170795
1-[3-chloro-4-(difluoromethoxy)phenyl]-3-prop-2-enylthiourea (PubChem CID 2170795) has the molecular formula C11H11ClF2N2OS and a molecular weight of 292.74 g/mol. Its IUPAC name is 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 2170795 |
| Molecular Formula | C11H11ClF2N2OS |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C11H11ClF2N2OS/c1-2-5-15-11(18)16-7-3-4-9(8(12)6-7)17-10(13)14/h2-4,6,10H,1,5H2,(H2,15,16,18) |
| InChIKey | UFVYLJFBEGCJRG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|