C15H11ClF3NO2 — CID 4842173
N-[3-chloro-4-(difluoromethoxy)phenyl]-2-(4-fluorophenyl)acetamide (PubChem CID 4842173) has the molecular formula C15H11ClF3NO2 and a molecular weight of 329.71 g/mol. Its IUPAC name is N-[3-chloro-4-(difluoromethoxy)phenyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 4842173 |
| Molecular Formula | C15H11ClF3NO2 |
| Molecular Weight | 329.71 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C15H11ClF3NO2/c16-12-8-11(5-6-13(12)22-15(18)19)20-14(21)7-9-1-3-10(17)4-2-9/h1-6,8,15H,7H2,(H,20,21) |
| InChIKey | PECYYYJUTVHQOP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.71 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |