C12H15ClF2N2O2 — CID 61258739
N-[3-chloro-4-(difluoromethoxy)phenyl]-4-(methylamino)butanamide (PubChem CID 61258739) has the molecular formula C12H15ClF2N2O2 and a molecular weight of 292.71 g/mol. Its IUPAC name is N-[3-chloro-4-(difluoromethoxy)phenyl]-4-(methylamino)butanamide.
| Compound Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 61258739 |
| Molecular Formula | C12H15ClF2N2O2 |
| Molecular Weight | 292.71 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | N-[3-chloro-4-(difluoromethoxy)phenyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClF2N2O2/c1-16-6-2-3-11(18)17-8-4-5-10(9(13)7-8)19-12(14)15/h4-5,7,12,16H,2-3,6H2,1H3,(H,17,18) |
| InChIKey | WUYSUTQJGZROPO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.71 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|