C10H10ClF2NO3 — CID 60637785
ethyl N-[3-chloro-4-(difluoromethoxy)phenyl]carbamate (PubChem CID 60637785) has the molecular formula C10H10ClF2NO3 and a molecular weight of 265.64 g/mol. Its IUPAC name is ethyl N-[3-chloro-4-(difluoromethoxy)phenyl]carbamate.
| Compound Name | ethyl N-[3-chloro-4-(difluoromethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 60637785 |
| Molecular Formula | C10H10ClF2NO3 |
| Molecular Weight | 265.64 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | ethyl N-[3-chloro-4-(difluoromethoxy)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H10ClF2NO3/c1-2-16-10(15)14-6-3-4-8(7(11)5-6)17-9(12)13/h3-5,9H,2H2,1H3,(H,14,15) |
| InChIKey | HIQRPGYGJWYPSO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |