C15H14ClF2N3O4 — CID 19267096
ethyl 3-[[3-chloro-4-(difluoromethoxy)phenyl]carbamoyl]-1-methylpyrazole-5-carboxylate (PubChem CID 19267096) has the molecular formula C15H14ClF2N3O4 and a molecular weight of 373.74 g/mol. Its IUPAC name is ethyl 3-[[3-chloro-4-(difluoromethoxy)phenyl]carbamoyl]-1-methylpyrazole-5-carboxylate.
| Compound Name | ethyl 3-[[3-chloro-4-(difluoromethoxy)phenyl]carbamoyl]-1-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 19267096 |
| Molecular Formula | C15H14ClF2N3O4 |
| Molecular Weight | 373.74 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | ethyl 3-[[3-chloro-4-(difluoromethoxy)phenyl]carbamoyl]-1-methylpyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)Nc2ccc(OC(F)F)c(Cl)c2)nn1C |
| InChI | InChI=1S/C15H14ClF2N3O4/c1-3-24-14(23)11-7-10(20-21(11)2)13(22)19-8-4-5-12(9(16)6-8)25-15(17)18/h4-7,15H,3H2,1-2H3,(H,19,22) |
| InChIKey | LMUFRBJFBKUIEU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.74 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |