C12H15ClF2N2O2 — CID 79806067
2-amino-N-[3-chloro-4-(difluoromethoxy)phenyl]-2-methylbutanamide (PubChem CID 79806067) has the molecular formula C12H15ClF2N2O2 and a molecular weight of 292.71 g/mol. Its IUPAC name is 2-amino-N-[3-chloro-4-(difluoromethoxy)phenyl]-2-methylbutanamide.
| Compound Name | 2-amino-N-[3-chloro-4-(difluoromethoxy)phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 79806067 |
| Molecular Formula | C12H15ClF2N2O2 |
| Molecular Weight | 292.71 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-amino-N-[3-chloro-4-(difluoromethoxy)phenyl]-2-methylbutanamide |
| SMILES | CCC(C)(N)C(=O)Nc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClF2N2O2/c1-3-12(2,16)10(18)17-7-4-5-9(8(13)6-7)19-11(14)15/h4-6,11H,3,16H2,1-2H3,(H,17,18) |
| InChIKey | DQMLDAWFKQSUGF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |