C16H15ClF2N2O4 — CID 1297847
1-[3-chloro-4-(difluoromethoxy)phenyl]-3-(3,4-dimethoxyphenyl)urea (PubChem CID 1297847) has the molecular formula C16H15ClF2N2O4 and a molecular weight of 372.76 g/mol. Its IUPAC name is 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-(3,4-dimethoxyphenyl)urea.
| Compound Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-(3,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 1297847 |
| Molecular Formula | C16H15ClF2N2O4 |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 1-[3-chloro-4-(difluoromethoxy)phenyl]-3-(3,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(OC(F)F)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C16H15ClF2N2O4/c1-23-13-6-4-10(8-14(13)24-2)21-16(22)20-9-3-5-12(11(17)7-9)25-15(18)19/h3-8,15H,1-2H3,(H2,20,21,22) |
| InChIKey | ZOMBKVXLBMUSRQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |