C16H13Cl2F2NO3 — CID 55539749
2-(2,4-dichlorophenyl)-N-[3-(difluoromethoxy)-4-methoxyphenyl]acetamide (PubChem CID 55539749) has the molecular formula C16H13Cl2F2NO3 and a molecular weight of 376.19 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[3-(difluoromethoxy)-4-methoxyphenyl]acetamide.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[3-(difluoromethoxy)-4-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 55539749 |
| Molecular Formula | C16H13Cl2F2NO3 |
| Molecular Weight | 376.19 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[3-(difluoromethoxy)-4-methoxyphenyl]acetamide |
| SMILES | COc1ccc(NC(=O)Cc2ccc(Cl)cc2Cl)cc1OC(F)F |
| InChI | InChI=1S/C16H13Cl2F2NO3/c1-23-13-5-4-11(8-14(13)24-16(19)20)21-15(22)6-9-2-3-10(17)7-12(9)18/h2-5,7-8,16H,6H2,1H3,(H,21,22) |
| InChIKey | QBCNCLONMBTJKJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.19 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |