C17H16Cl2F2N2O3 — CID 42941663
N-(2,5-dichlorophenyl)-2-[3-(difluoromethoxy)-4-methoxyanilino]propanamide (PubChem CID 42941663) has the molecular formula C17H16Cl2F2N2O3 and a molecular weight of 405.23 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[3-(difluoromethoxy)-4-methoxyanilino]propanamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[3-(difluoromethoxy)-4-methoxyanilino]propanamide |
|---|---|
| PubChem CID | 42941663 |
| Molecular Formula | C17H16Cl2F2N2O3 |
| Molecular Weight | 405.23 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[3-(difluoromethoxy)-4-methoxyanilino]propanamide |
| SMILES | COc1ccc(NC(C)C(=O)Nc2cc(Cl)ccc2Cl)cc1OC(F)F |
| InChI | InChI=1S/C17H16Cl2F2N2O3/c1-9(16(24)23-13-7-10(18)3-5-12(13)19)22-11-4-6-14(25-2)15(8-11)26-17(20)21/h3-9,17,22H,1-2H3,(H,23,24) |
| InChIKey | IGLIAXILIJPKHF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.23 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|