C18H20F2N2O3 — CID 24652308
2-[3-(difluoromethoxy)-4-methoxyanilino]-N-(2-methylphenyl)propanamide (PubChem CID 24652308) has the molecular formula C18H20F2N2O3 and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)-4-methoxyanilino]-N-(2-methylphenyl)propanamide.
| Compound Name | 2-[3-(difluoromethoxy)-4-methoxyanilino]-N-(2-methylphenyl)propanamide |
|---|---|
| PubChem CID | 24652308 |
| Molecular Formula | C18H20F2N2O3 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-[3-(difluoromethoxy)-4-methoxyanilino]-N-(2-methylphenyl)propanamide |
| SMILES | COc1ccc(NC(C)C(=O)Nc2ccccc2C)cc1OC(F)F |
| InChI | InChI=1S/C18H20F2N2O3/c1-11-6-4-5-7-14(11)22-17(23)12(2)21-13-8-9-15(24-3)16(10-13)25-18(19)20/h4-10,12,18,21H,1-3H3,(H,22,23) |
| InChIKey | LJRVPPKIIXEULU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|