C18H20F2N2O2 — CID 25346916
(2R)-N-[2-(difluoromethoxy)phenyl]-2-(3,4-dimethylanilino)propanamide (PubChem CID 25346916) has the molecular formula C18H20F2N2O2 and a molecular weight of 334.37 g/mol. Its IUPAC name is (2R)-N-[2-(difluoromethoxy)phenyl]-2-(3,4-dimethylanilino)propanamide.
| Compound Name | (2R)-N-[2-(difluoromethoxy)phenyl]-2-(3,4-dimethylanilino)propanamide |
|---|---|
| PubChem CID | 25346916 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (2R)-N-[2-(difluoromethoxy)phenyl]-2-(3,4-dimethylanilino)propanamide |
| SMILES | Cc1ccc(N[C@H](C)C(=O)Nc2ccccc2OC(F)F)cc1C |
| InChI | InChI=1S/C18H20F2N2O2/c1-11-8-9-14(10-12(11)2)21-13(3)17(23)22-15-6-4-5-7-16(15)24-18(19)20/h4-10,13,18,21H,1-3H3,(H,22,23)/t13-/m1/s1 |
| InChIKey | GCNHCBKSDYYEKE-CYBMUJFWSA-N |
| XLogP | 4.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |