C18H20F2N2O4 — CID 134039312
2-[3-(difluoromethoxy)-4-methoxyanilino]-N-(4-methoxyphenyl)propanamide (PubChem CID 134039312) has the molecular formula C18H20F2N2O4 and a molecular weight of 366.36 g/mol. Its IUPAC name is 2-[3-(difluoromethoxy)-4-methoxyanilino]-N-(4-methoxyphenyl)propanamide.
| Compound Name | 2-[3-(difluoromethoxy)-4-methoxyanilino]-N-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 134039312 |
| Molecular Formula | C18H20F2N2O4 |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-[3-(difluoromethoxy)-4-methoxyanilino]-N-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)C(C)Nc2ccc(OC)c(OC(F)F)c2)cc1 |
| InChI | InChI=1S/C18H20F2N2O4/c1-11(17(23)22-12-4-7-14(24-2)8-5-12)21-13-6-9-15(25-3)16(10-13)26-18(19)20/h4-11,18,21H,1-3H3,(H,22,23) |
| InChIKey | MDKXWAQBSHXJRB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|