C15H19F2N3O4 — CID 24652338
N-(cyclopropylcarbamoyl)-2-[3-(difluoromethoxy)-4-methoxyanilino]propanamide (PubChem CID 24652338) has the molecular formula C15H19F2N3O4 and a molecular weight of 343.33 g/mol. Its IUPAC name is N-(cyclopropylcarbamoyl)-2-[3-(difluoromethoxy)-4-methoxyanilino]propanamide.
| Compound Name | N-(cyclopropylcarbamoyl)-2-[3-(difluoromethoxy)-4-methoxyanilino]propanamide |
|---|---|
| PubChem CID | 24652338 |
| Molecular Formula | C15H19F2N3O4 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-(cyclopropylcarbamoyl)-2-[3-(difluoromethoxy)-4-methoxyanilino]propanamide |
| SMILES | COc1ccc(NC(C)C(=O)NC(=O)NC2CC2)cc1OC(F)F |
| InChI | InChI=1S/C15H19F2N3O4/c1-8(13(21)20-15(22)19-9-3-4-9)18-10-5-6-11(23-2)12(7-10)24-14(16)17/h5-9,14,18H,3-4H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | MVQVTIQELRPENF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|