C15H21N3O4 — CID 51281614
N-(cyclopropylcarbamoyl)-2-(2,4-dimethoxyanilino)propanamide (PubChem CID 51281614) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-(cyclopropylcarbamoyl)-2-(2,4-dimethoxyanilino)propanamide.
| Compound Name | N-(cyclopropylcarbamoyl)-2-(2,4-dimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 51281614 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | N-(cyclopropylcarbamoyl)-2-(2,4-dimethoxyanilino)propanamide |
| SMILES | COc1ccc(NC(C)C(=O)NC(=O)NC2CC2)c(OC)c1 |
| InChI | InChI=1S/C15H21N3O4/c1-9(14(19)18-15(20)17-10-4-5-10)16-12-7-6-11(21-2)8-13(12)22-3/h6-10,16H,4-5H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | SHOTWVVPQGKAGG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|