C19H20N2O4 — CID 109043393
1-N-cyclopropyl-4-N-(2,4-dimethoxyphenyl)benzene-1,4-dicarboxamide (PubChem CID 109043393) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-N-cyclopropyl-4-N-(2,4-dimethoxyphenyl)benzene-1,4-dicarboxamide.
| Compound Name | 1-N-cyclopropyl-4-N-(2,4-dimethoxyphenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109043393 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-N-cyclopropyl-4-N-(2,4-dimethoxyphenyl)benzene-1,4-dicarboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(C(=O)NC3CC3)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-24-15-9-10-16(17(11-15)25-2)21-19(23)13-5-3-12(4-6-13)18(22)20-14-7-8-14/h3-6,9-11,14H,7-8H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | YTRDOIBZUDVMGL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |