C22H26N2O4 — CID 109052232
3-N-cyclohexyl-1-N-(2,4-dimethoxyphenyl)benzene-1,3-dicarboxamide (PubChem CID 109052232) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-N-cyclohexyl-1-N-(2,4-dimethoxyphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 3-N-cyclohexyl-1-N-(2,4-dimethoxyphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109052232 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 3-N-cyclohexyl-1-N-(2,4-dimethoxyphenyl)benzene-1,3-dicarboxamide |
| SMILES | COc1ccc(NC(=O)c2cccc(C(=O)NC3CCCCC3)c2)c(OC)c1 |
| InChI | InChI=1S/C22H26N2O4/c1-27-18-11-12-19(20(14-18)28-2)24-22(26)16-8-6-7-15(13-16)21(25)23-17-9-4-3-5-10-17/h6-8,11-14,17H,3-5,9-10H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | RVXSSKNKSLTFAC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |