C17H26N2O3 — CID 92717913
(2S)-N-cyclohexyl-2-(2,4-dimethoxyanilino)propanamide (PubChem CID 92717913) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-(2,4-dimethoxyanilino)propanamide.
| Compound Name | (2S)-N-cyclohexyl-2-(2,4-dimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 92717913 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2S)-N-cyclohexyl-2-(2,4-dimethoxyanilino)propanamide |
| SMILES | COc1ccc(N[C@@H](C)C(=O)NC2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C17H26N2O3/c1-12(17(20)19-13-7-5-4-6-8-13)18-15-10-9-14(21-2)11-16(15)22-3/h9-13,18H,4-8H2,1-3H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | VJSJNYGNIBRERF-LBPRGKRZSA-N |
| XLogP | 2.95 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|