C16H25N3O4 — CID 35969817
(2S)-N-(tert-butylcarbamoyl)-2-(2,4-dimethoxyanilino)propanamide (PubChem CID 35969817) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is (2S)-N-(tert-butylcarbamoyl)-2-(2,4-dimethoxyanilino)propanamide.
| Compound Name | (2S)-N-(tert-butylcarbamoyl)-2-(2,4-dimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 35969817 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | (2S)-N-(tert-butylcarbamoyl)-2-(2,4-dimethoxyanilino)propanamide |
| SMILES | COc1ccc(N[C@@H](C)C(=O)NC(=O)NC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C16H25N3O4/c1-10(14(20)18-15(21)19-16(2,3)4)17-12-8-7-11(22-5)9-13(12)23-6/h7-10,17H,1-6H3,(H2,18,19,20,21)/t10-/m0/s1 |
| InChIKey | FPJKYMWNFUFXER-JTQLQIEISA-N |
| XLogP | 2.13 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|