C17H27N3O5 — CID 46666987
N-(tert-butylcarbamoyl)-2-(3,4,5-trimethoxyanilino)propanamide (PubChem CID 46666987) has the molecular formula C17H27N3O5 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-(tert-butylcarbamoyl)-2-(3,4,5-trimethoxyanilino)propanamide.
| Compound Name | N-(tert-butylcarbamoyl)-2-(3,4,5-trimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 46666987 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | N-(tert-butylcarbamoyl)-2-(3,4,5-trimethoxyanilino)propanamide |
| SMILES | COc1cc(NC(C)C(=O)NC(=O)NC(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C17H27N3O5/c1-10(15(21)19-16(22)20-17(2,3)4)18-11-8-12(23-5)14(25-7)13(9-11)24-6/h8-10,18H,1-7H3,(H2,19,20,21,22) |
| InChIKey | XYIAKAVQVSZFFA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|