C14H18Br2N2O5 — CID 21423279
2,3-dibromo-N-[(3,4,5-trimethoxyphenyl)carbamoyl]butanamide (PubChem CID 21423279) has the molecular formula C14H18Br2N2O5 and a molecular weight of 454.12 g/mol. Its IUPAC name is 2,3-dibromo-N-[(3,4,5-trimethoxyphenyl)carbamoyl]butanamide.
| Compound Name | 2,3-dibromo-N-[(3,4,5-trimethoxyphenyl)carbamoyl]butanamide |
|---|---|
| PubChem CID | 21423279 |
| Molecular Formula | C14H18Br2N2O5 |
| Molecular Weight | 454.12 g/mol |
| Exact Mass | 451.96 |
| IUPAC Name | 2,3-dibromo-N-[(3,4,5-trimethoxyphenyl)carbamoyl]butanamide |
| SMILES | COc1cc(NC(=O)NC(=O)C(Br)C(C)Br)cc(OC)c1OC |
| InChI | InChI=1S/C14H18Br2N2O5/c1-7(15)11(16)13(19)18-14(20)17-8-5-9(21-2)12(23-4)10(6-8)22-3/h5-7,11H,1-4H3,(H2,17,18,19,20) |
| InChIKey | SCMODZAQYLDPSL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.12 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|