C15H24N2O4 — CID 24710340
2-amino-4-methyl-N-(3,4,5-trimethoxyphenyl)pentanamide (PubChem CID 24710340) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-amino-4-methyl-N-(3,4,5-trimethoxyphenyl)pentanamide.
| Compound Name | 2-amino-4-methyl-N-(3,4,5-trimethoxyphenyl)pentanamide |
|---|---|
| PubChem CID | 24710340 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-amino-4-methyl-N-(3,4,5-trimethoxyphenyl)pentanamide |
| SMILES | COc1cc(NC(=O)C(N)CC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C15H24N2O4/c1-9(2)6-11(16)15(18)17-10-7-12(19-3)14(21-5)13(8-10)20-4/h7-9,11H,6,16H2,1-5H3,(H,17,18) |
| InChIKey | QSEVPRSFBZNEMA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |