C24H28N2O6 — CID 170454003
(2S)-2-amino-4-methyl-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]pentanamide (PubChem CID 170454003) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]pentanamide |
|---|---|
| PubChem CID | 170454003 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[3-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl]pentanamide |
| SMILES | COc1cc2oc(-c3cccc(NC(=O)[C@@H](N)CC(C)C)c3)cc(=O)c2c(OC)c1OC |
| InChI | InChI=1S/C24H28N2O6/c1-13(2)9-16(25)24(28)26-15-8-6-7-14(10-15)18-11-17(27)21-19(32-18)12-20(29-3)22(30-4)23(21)31-5/h6-8,10-13,16H,9,25H2,1-5H3,(H,26,28)/t16-/m0/s1 |
| InChIKey | SEXBYJYYSKUQJH-INIZCTEOSA-N |
| XLogP | 3.80 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |