C22H23NO7 — CID 66783370
ethyl 2-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)anilino]acetate (PubChem CID 66783370) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is ethyl 2-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)anilino]acetate.
| Compound Name | ethyl 2-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)anilino]acetate |
|---|---|
| PubChem CID | 66783370 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | ethyl 2-[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)anilino]acetate |
| SMILES | CCOC(=O)CNc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)cc3o2)cc1 |
| InChI | InChI=1S/C22H23NO7/c1-5-29-19(25)12-23-14-8-6-13(7-9-14)16-10-15(24)20-17(30-16)11-18(26-2)21(27-3)22(20)28-4/h6-11,23H,5,12H2,1-4H3 |
| InChIKey | LJDHRAZKTZMVCE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |