C30H30N2O7 — CID 118728182
[4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl] 4-benzylpiperazine-1-carboxylate (PubChem CID 118728182) has the molecular formula C30H30N2O7 and a molecular weight of 530.58 g/mol. Its IUPAC name is [4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl] 4-benzylpiperazine-1-carboxylate.
| Compound Name | [4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl] 4-benzylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 118728182 |
| Molecular Formula | C30H30N2O7 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | [4-(5,6,7-trimethoxy-4-oxochromen-2-yl)phenyl] 4-benzylpiperazine-1-carboxylate |
| SMILES | COc1cc2oc(-c3ccc(OC(=O)N4CCN(Cc5ccccc5)CC4)cc3)cc(=O)c2c(OC)c1OC |
| InChI | InChI=1S/C30H30N2O7/c1-35-26-18-25-27(29(37-3)28(26)36-2)23(33)17-24(39-25)21-9-11-22(12-10-21)38-30(34)32-15-13-31(14-16-32)19-20-7-5-4-6-8-20/h4-12,17-18H,13-16,19H2,1-3H3 |
| InChIKey | FJZXVHORWNHJFF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 90.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |