C21H20N2O7 — CID 122196268
[4-(5,6,7-trihydroxy-4-oxochromen-2-yl)phenyl] 4-methylpiperazine-1-carboxylate (PubChem CID 122196268) has the molecular formula C21H20N2O7 and a molecular weight of 412.40 g/mol. Its IUPAC name is [4-(5,6,7-trihydroxy-4-oxochromen-2-yl)phenyl] 4-methylpiperazine-1-carboxylate.
| Compound Name | [4-(5,6,7-trihydroxy-4-oxochromen-2-yl)phenyl] 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 122196268 |
| Molecular Formula | C21H20N2O7 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [4-(5,6,7-trihydroxy-4-oxochromen-2-yl)phenyl] 4-methylpiperazine-1-carboxylate |
| SMILES | CN1CCN(C(=O)Oc2ccc(-c3cc(=O)c4c(O)c(O)c(O)cc4o3)cc2)CC1 |
| InChI | InChI=1S/C21H20N2O7/c1-22-6-8-23(9-7-22)21(28)29-13-4-2-12(3-5-13)16-10-14(24)18-17(30-16)11-15(25)19(26)20(18)27/h2-5,10-11,25-27H,6-9H2,1H3 |
| InChIKey | GFDQFAHLYHQQLT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|