C15H11NaO5 — CID 174885991
sodium;hydride;5,6,7-trihydroxy-2-phenylchromen-4-one (PubChem CID 174885991) has the molecular formula C15H11NaO5 and a molecular weight of 294.24 g/mol. Its IUPAC name is sodium;hydride;5,6,7-trihydroxy-2-phenylchromen-4-one.
| Compound Name | sodium;hydride;5,6,7-trihydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 174885991 |
| Molecular Formula | C15H11NaO5 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | sodium;hydride;5,6,7-trihydroxy-2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(O)c(O)c(O)c12.[H-].[Na+] |
| InChI | InChI=1S/C15H10O5.Na.H/c16-9-6-11(8-4-2-1-3-5-8)20-12-7-10(17)14(18)15(19)13(9)12;;/h1-7,17-19H;;/q;+1;-1 |
| InChIKey | YCKLZQFCVAGXJK-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|