C22H16O5 — CID 15108702
5,6-dihydroxy-2-phenyl-7-phenylmethoxychromen-4-one (PubChem CID 15108702) has the molecular formula C22H16O5 and a molecular weight of 360.37 g/mol. Its IUPAC name is 5,6-dihydroxy-2-phenyl-7-phenylmethoxychromen-4-one.
| Compound Name | 5,6-dihydroxy-2-phenyl-7-phenylmethoxychromen-4-one |
|---|---|
| PubChem CID | 15108702 |
| Molecular Formula | C22H16O5 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 5,6-dihydroxy-2-phenyl-7-phenylmethoxychromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(OCc3ccccc3)c(O)c(O)c12 |
| InChI | InChI=1S/C22H16O5/c23-16-11-17(15-9-5-2-6-10-15)27-18-12-19(21(24)22(25)20(16)18)26-13-14-7-3-1-4-8-14/h1-12,24-25H,13H2 |
| InChIKey | NCLZLANNNNTMLM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|