C31H22O11 — CID 175123321
formaldehyde;bis(5,6,7-trihydroxy-2-phenylchromen-4-one) (PubChem CID 175123321) has the molecular formula C31H22O11 and a molecular weight of 570.51 g/mol. Its IUPAC name is formaldehyde;bis(5,6,7-trihydroxy-2-phenylchromen-4-one).
| Compound Name | formaldehyde;bis(5,6,7-trihydroxy-2-phenylchromen-4-one) |
|---|---|
| PubChem CID | 175123321 |
| Molecular Formula | C31H22O11 |
| Molecular Weight | 570.51 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | formaldehyde;bis(5,6,7-trihydroxy-2-phenylchromen-4-one) |
| SMILES | C=O.O=c1cc(-c2ccccc2)oc2cc(O)c(O)c(O)c12.O=c1cc(-c2ccccc2)oc2cc(O)c(O)c(O)c12 |
| InChI | InChI=1S/2C15H10O5.CH2O/c2*16-9-6-11(8-4-2-1-3-5-8)20-12-7-10(17)14(18)15(19)13(9)12;1-2/h2*1-7,17-19H;1H2 |
| InChIKey | NYVKGMNTIFPSDI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 198.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|