C21H26O5 — CID 145053465
ethane;6-ethoxy-5,7-dihydroxy-2-phenylchromen-4-one (PubChem CID 145053465) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is ethane;6-ethoxy-5,7-dihydroxy-2-phenylchromen-4-one.
| Compound Name | ethane;6-ethoxy-5,7-dihydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 145053465 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | ethane;6-ethoxy-5,7-dihydroxy-2-phenylchromen-4-one |
| SMILES | CC.CC.CCOc1c(O)cc2oc(-c3ccccc3)cc(=O)c2c1O |
| InChI | InChI=1S/C17H14O5.2C2H6/c1-2-21-17-12(19)9-14-15(16(17)20)11(18)8-13(22-14)10-6-4-3-5-7-10;2*1-2/h3-9,19-20H,2H2,1H3;2*1-2H3 |
| InChIKey | XICOPAYWDGRJFP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |