C27H20N2O5 — CID 174845080
diphenyldiazene;5,6,7-trihydroxy-2-phenylchromen-4-one (PubChem CID 174845080) has the molecular formula C27H20N2O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is diphenyldiazene;5,6,7-trihydroxy-2-phenylchromen-4-one.
| Compound Name | diphenyldiazene;5,6,7-trihydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 174845080 |
| Molecular Formula | C27H20N2O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | diphenyldiazene;5,6,7-trihydroxy-2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(O)c(O)c(O)c12.c1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C15H10O5.C12H10N2/c16-9-6-11(8-4-2-1-3-5-8)20-12-7-10(17)14(18)15(19)13(9)12;1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-7,17-19H;1-10H/b;14-13+ |
| InChIKey | VUFUIPKJCBVIDV-SLTJUJPSSA-N |
| XLogP | 6.68 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|