C46H32O14 — CID 159238028
5,7-dihydroxy-6-(hydroxymethyl)-2-phenylchromen-4-one;5,7-dihydroxy-2-phenylchromen-4-one;5,6,7-trihydroxy-2-phenylchromen-4-one (PubChem CID 159238028) has the molecular formula C46H32O14 and a molecular weight of 808.75 g/mol. Its IUPAC name is 5,7-dihydroxy-6-(hydroxymethyl)-2-phenylchromen-4-one;5,7-dihydroxy-2-phenylchromen-4-one;5,6,7-trihydroxy-2-phenylchromen-4-one.
| Compound Name | 5,7-dihydroxy-6-(hydroxymethyl)-2-phenylchromen-4-one;5,7-dihydroxy-2-phenylchromen-4-one;5,6,7-trihydroxy-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 159238028 |
| Molecular Formula | C46H32O14 |
| Molecular Weight | 808.75 g/mol |
| Exact Mass | 808.18 |
| IUPAC Name | 5,7-dihydroxy-6-(hydroxymethyl)-2-phenylchromen-4-one;5,7-dihydroxy-2-phenylchromen-4-one;5,6,7-trihydroxy-2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(O)c(CO)c(O)c12.O=c1cc(-c2ccccc2)oc2cc(O)c(O)c(O)c12.O=c1cc(-c2ccccc2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C16H12O5.C15H10O5.C15H10O4/c17-8-10-11(18)6-14-15(16(10)20)12(19)7-13(21-14)9-4-2-1-3-5-9;16-9-6-11(8-4-2-1-3-5-8)20-12-7-10(17)14(18)15(19)13(9)12;16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9/h1-7,17-18,20H,8H2;1-7,17-19H;1-8,16-17H |
| InChIKey | KTSOCVLVXGFDSK-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 252.47 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.75 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|