About 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one
5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one (PubChem CID 68816707) has the molecular formula C30H20O6
and a molecular weight of 476.48 g/mol. Its IUPAC name is 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one.
Molecular Properties
| Compound Name | 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one |
| PubChem CID | 68816707 |
| Molecular Formula | C30H20O6 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(O)cc(O)c12.O=c1cc(-c2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C15H10O4.C15H10O2/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9;16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-8,16-17H;1-10H |
| InChIKey | KLKLLWSQMAVJPN-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one?
The IUPAC name of 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one (CID 68816707) is 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one.
What is the SMILES notation for 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one?
The canonical SMILES for 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one is O=c1cc(-c2ccccc2)oc2cc(O)cc(O)c12.O=c1cc(-c2ccccc2)oc2ccccc12.
What is the InChIKey of 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one?
The InChIKey is KLKLLWSQMAVJPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O4.C15H10O2/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9;16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-8,16-17H;1-10H.
What are the key properties of 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one?
5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one has a molecular weight of 476.48 g/mol, XLogP of 6.33, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one is sourced from PubChem (CID 68816707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).