C30H20O6 — CID 68816707
5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one (PubChem CID 68816707) has the molecular formula C30H20O6 and a molecular weight of 476.48 g/mol. Its IUPAC name is 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one.
| Compound Name | 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one |
|---|---|
| PubChem CID | 68816707 |
| Molecular Formula | C30H20O6 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | 5,7-dihydroxy-2-phenylchromen-4-one;2-phenylchromen-4-one |
| SMILES | O=c1cc(-c2ccccc2)oc2cc(O)cc(O)c12.O=c1cc(-c2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C15H10O4.C15H10O2/c16-10-6-11(17)15-12(18)8-13(19-14(15)7-10)9-4-2-1-3-5-9;16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-8,16-17H;1-10H |
| InChIKey | KLKLLWSQMAVJPN-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |